About 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine
5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine (PubChem CID 79548195) has the molecular formula C8H11F3N4
and a molecular weight of 220.20 g/mol. Its IUPAC name is 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine.
Molecular Properties
| Compound Name | 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine |
| PubChem CID | 79548195 |
| Molecular Formula | C8H11F3N4 |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine |
| SMILES | Nc1nnn(CCC(F)(F)F)c1C1CC1 |
| InChI | InChI=1S/C8H11F3N4/c9-8(10,11)3-4-15-6(5-1-2-5)7(12)13-14-15/h5H,1-4,12H2 |
| InChIKey | XBKPKTUZPZNUQB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
The IUPAC name of 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine (CID 79548195) is 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine.
What is the SMILES notation for 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
The canonical SMILES for 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine is Nc1nnn(CCC(F)(F)F)c1C1CC1.
What is the InChIKey of 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
The InChIKey is XBKPKTUZPZNUQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F3N4/c9-8(10,11)3-4-15-6(5-1-2-5)7(12)13-14-15/h5H,1-4,12H2.
What are the key properties of 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine has a molecular weight of 220.20 g/mol, XLogP of 1.69, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopropyl-1-(3,3,3-trifluoropropyl)triazol-4-amine is sourced from PubChem (CID 79548195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).