About 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine
5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine (PubChem CID 79548263) has the molecular formula C9H15F3N4
and a molecular weight of 236.24 g/mol. Its IUPAC name is 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine.
Molecular Properties
| Compound Name | 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine |
| PubChem CID | 79548263 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine |
| SMILES | CC(C)(C)c1c(N)nnn1CCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N4/c1-8(2,3)6-7(13)14-15-16(6)5-4-9(10,11)12/h4-5,13H2,1-3H3 |
| InChIKey | RGRXCRXMNFUPAT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
The IUPAC name of 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine (CID 79548263) is 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine.
What is the SMILES notation for 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
The canonical SMILES for 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine is CC(C)(C)c1c(N)nnn1CCC(F)(F)F.
What is the InChIKey of 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
The InChIKey is RGRXCRXMNFUPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N4/c1-8(2,3)6-7(13)14-15-16(6)5-4-9(10,11)12/h4-5,13H2,1-3H3.
What are the key properties of 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine?
5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine has a molecular weight of 236.24 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-1-(3,3,3-trifluoropropyl)triazol-4-amine is sourced from PubChem (CID 79548263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).