About [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (PubChem CID 7954832) has the molecular formula C16H18N2O4S
and a molecular weight of 334.40 g/mol. Its IUPAC name is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 7954832 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate |
| SMILES | COc1ccccc1CNC(=O)COC(=O)c1sc(C)nc1C |
| InChI | InChI=1S/C16H18N2O4S/c1-10-15(23-11(2)18-10)16(20)22-9-14(19)17-8-12-6-4-5-7-13(12)21-3/h4-7H,8-9H2,1-3H3,(H,17,19) |
| InChIKey | BNVPAGQCCISIPN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The IUPAC name of [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate (CID 7954832) is [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate is COc1ccccc1CNC(=O)COC(=O)c1sc(C)nc1C.
What is the InChIKey of [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
The InChIKey is BNVPAGQCCISIPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O4S/c1-10-15(23-11(2)18-10)16(20)22-9-14(19)17-8-12-6-4-5-7-13(12)21-3/h4-7H,8-9H2,1-3H3,(H,17,19).
What are the key properties of [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate?
[2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate has a molecular weight of 334.40 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2-methoxyphenyl)methylamino]-2-oxoethyl] 2,4-dimethyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 7954832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).