C15H24N2O3 — CID 79548465
N-[2-[(2,2-diethoxyethylamino)methyl]phenyl]acetamide (PubChem CID 79548465) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-[2-[(2,2-diethoxyethylamino)methyl]phenyl]acetamide.
| Compound Name | N-[2-[(2,2-diethoxyethylamino)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 79548465 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-[2-[(2,2-diethoxyethylamino)methyl]phenyl]acetamide |
| SMILES | CCOC(CNCc1ccccc1NC(C)=O)OCC |
| InChI | InChI=1S/C15H24N2O3/c1-4-19-15(20-5-2)11-16-10-13-8-6-7-9-14(13)17-12(3)18/h6-9,15-16H,4-5,10-11H2,1-3H3,(H,17,18) |
| InChIKey | WNTSVZGTTNMLRM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|