About N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine
N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine (PubChem CID 79548478) has the molecular formula C11H18ClNO2S
and a molecular weight of 263.79 g/mol. Its IUPAC name is N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine.
Molecular Properties
| Compound Name | N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine |
| PubChem CID | 79548478 |
| Molecular Formula | C11H18ClNO2S |
| Molecular Weight | 263.79 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine |
| SMILES | CCOC(CNCc1cc(Cl)cs1)OCC |
| InChI | InChI=1S/C11H18ClNO2S/c1-3-14-11(15-4-2)7-13-6-10-5-9(12)8-16-10/h5,8,11,13H,3-4,6-7H2,1-2H3 |
| InChIKey | QAHYEHMCZKWEBL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine?
The IUPAC name of N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine (CID 79548478) is N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine.
What is the SMILES notation for N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine?
The canonical SMILES for N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine is CCOC(CNCc1cc(Cl)cs1)OCC.
What is the InChIKey of N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine?
The InChIKey is QAHYEHMCZKWEBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18ClNO2S/c1-3-14-11(15-4-2)7-13-6-10-5-9(12)8-16-10/h5,8,11,13H,3-4,6-7H2,1-2H3.
What are the key properties of N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine?
N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine has a molecular weight of 263.79 g/mol, XLogP of 2.89, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-chlorothiophen-2-yl)methyl]-2,2-diethoxyethanamine is sourced from PubChem (CID 79548478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).