C17H23NO2 — CID 79549380
1-[1-(3,4-dimethylbenzoyl)piperidin-2-yl]propan-2-one (PubChem CID 79549380) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylbenzoyl)piperidin-2-yl]propan-2-one.
| Compound Name | 1-[1-(3,4-dimethylbenzoyl)piperidin-2-yl]propan-2-one |
|---|---|
| PubChem CID | 79549380 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 1-[1-(3,4-dimethylbenzoyl)piperidin-2-yl]propan-2-one |
| SMILES | CC(=O)CC1CCCCN1C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H23NO2/c1-12-7-8-15(10-13(12)2)17(20)18-9-5-4-6-16(18)11-14(3)19/h7-8,10,16H,4-6,9,11H2,1-3H3 |
| InChIKey | AXYCBOFINDSDHC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |