C11H18N2O4S2 — CID 79551722
3-amino-N-(2-methyl-2-methylsulfonylpropyl)benzenesulfonamide (PubChem CID 79551722) has the molecular formula C11H18N2O4S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 3-amino-N-(2-methyl-2-methylsulfonylpropyl)benzenesulfonamide.
| Compound Name | 3-amino-N-(2-methyl-2-methylsulfonylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79551722 |
| Molecular Formula | C11H18N2O4S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-amino-N-(2-methyl-2-methylsulfonylpropyl)benzenesulfonamide |
| SMILES | CC(C)(CNS(=O)(=O)c1cccc(N)c1)S(C)(=O)=O |
| InChI | InChI=1S/C11H18N2O4S2/c1-11(2,18(3,14)15)8-13-19(16,17)10-6-4-5-9(12)7-10/h4-7,13H,8,12H2,1-3H3 |
| InChIKey | WRZZKAQSSYRRCI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|