C10H23NO4S — CID 79551937
N-[2-(2-methoxyethoxy)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine (PubChem CID 79551937) has the molecular formula C10H23NO4S and a molecular weight of 253.36 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine.
| Compound Name | N-[2-(2-methoxyethoxy)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 79551937 |
| Molecular Formula | C10H23NO4S |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-[2-(2-methoxyethoxy)ethyl]-2-methyl-2-methylsulfonylpropan-1-amine |
| SMILES | COCCOCCNCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H23NO4S/c1-10(2,16(4,12)13)9-11-5-6-15-8-7-14-3/h11H,5-9H2,1-4H3 |
| InChIKey | KVQGPSZFXUKPJX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|