C13H27NO3S — CID 79552253
2-ethyl-2-methyl-N-(2-methyl-2-methylsulfonylpropyl)oxan-4-amine (PubChem CID 79552253) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 2-ethyl-2-methyl-N-(2-methyl-2-methylsulfonylpropyl)oxan-4-amine.
| Compound Name | 2-ethyl-2-methyl-N-(2-methyl-2-methylsulfonylpropyl)oxan-4-amine |
|---|---|
| PubChem CID | 79552253 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-ethyl-2-methyl-N-(2-methyl-2-methylsulfonylpropyl)oxan-4-amine |
| SMILES | CCC1(C)CC(NCC(C)(C)S(C)(=O)=O)CCO1 |
| InChI | InChI=1S/C13H27NO3S/c1-6-13(4)9-11(7-8-17-13)14-10-12(2,3)18(5,15)16/h11,14H,6-10H2,1-5H3 |
| InChIKey | UGCNVXCZZPLLTK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |