About 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol
4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol (PubChem CID 79552365) has the molecular formula C9H19NO5S2
and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol.
Molecular Properties
| Compound Name | 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol |
| PubChem CID | 79552365 |
| Molecular Formula | C9H19NO5S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol |
| SMILES | CC(C)(CNC1CS(=O)(=O)CC1O)S(C)(=O)=O |
| InChI | InChI=1S/C9H19NO5S2/c1-9(2,16(3,12)13)6-10-7-4-17(14,15)5-8(7)11/h7-8,10-11H,4-6H2,1-3H3 |
| InChIKey | BHUJBPOXCFENFW-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol?
The IUPAC name of 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol (CID 79552365) is 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol.
What is the SMILES notation for 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol?
The canonical SMILES for 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol is CC(C)(CNC1CS(=O)(=O)CC1O)S(C)(=O)=O.
What is the InChIKey of 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol?
The InChIKey is BHUJBPOXCFENFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO5S2/c1-9(2,16(3,12)13)6-10-7-4-17(14,15)5-8(7)11/h7-8,10-11H,4-6H2,1-3H3.
What are the key properties of 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol?
4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol has a molecular weight of 285.39 g/mol, XLogP of -1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-2-methylsulfonylpropyl)amino]-1,1-dioxothiolan-3-ol is sourced from PubChem (CID 79552365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).