C13H13N3S — CID 79552994
5-[[(6-methyl-2-pyridinyl)methylamino]methyl]thiophene-3-carbonitrile (PubChem CID 79552994) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 5-[[(6-methyl-2-pyridinyl)methylamino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[(6-methyl-2-pyridinyl)methylamino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79552994 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 5-[[(6-methyl-2-pyridinyl)methylamino]methyl]thiophene-3-carbonitrile |
| SMILES | Cc1cccc(CNCc2cc(C#N)cs2)n1 |
| InChI | InChI=1S/C13H13N3S/c1-10-3-2-4-12(16-10)7-15-8-13-5-11(6-14)9-17-13/h2-5,9,15H,7-8H2,1H3 |
| InChIKey | SKDQRVKYFIQLEH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |