C18H30N2 — CID 79553763
1-(azepan-2-yl)-N-[1-(2-methylphenyl)ethyl]propan-2-amine (PubChem CID 79553763) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 1-(azepan-2-yl)-N-[1-(2-methylphenyl)ethyl]propan-2-amine.
| Compound Name | 1-(azepan-2-yl)-N-[1-(2-methylphenyl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 79553763 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 1-(azepan-2-yl)-N-[1-(2-methylphenyl)ethyl]propan-2-amine |
| SMILES | Cc1ccccc1C(C)NC(C)CC1CCCCCN1 |
| InChI | InChI=1S/C18H30N2/c1-14-9-6-7-11-18(14)16(3)20-15(2)13-17-10-5-4-8-12-19-17/h6-7,9,11,15-17,19-20H,4-5,8,10,12-13H2,1-3H3 |
| InChIKey | UIMSUJQAOBUKLQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |