About 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid
4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid (PubChem CID 79553961) has the molecular formula C12H12ClN3O2S
and a molecular weight of 297.77 g/mol. Its IUPAC name is 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid |
| PubChem CID | 79553961 |
| Molecular Formula | C12H12ClN3O2S |
| Molecular Weight | 297.77 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid |
| SMILES | Cc1nn(C)c(CSc2ccnc(C(=O)O)c2)c1Cl |
| InChI | InChI=1S/C12H12ClN3O2S/c1-7-11(13)10(16(2)15-7)6-19-8-3-4-14-9(5-8)12(17)18/h3-5H,6H2,1-2H3,(H,17,18) |
| InChIKey | HFOXTGFLHYSUEL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid?
The IUPAC name of 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid (CID 79553961) is 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid?
The canonical SMILES for 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid is Cc1nn(C)c(CSc2ccnc(C(=O)O)c2)c1Cl.
What is the InChIKey of 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid?
The InChIKey is HFOXTGFLHYSUEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O2S/c1-7-11(13)10(16(2)15-7)6-19-8-3-4-14-9(5-8)12(17)18/h3-5H,6H2,1-2H3,(H,17,18).
What are the key properties of 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid?
4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid has a molecular weight of 297.77 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-chloro-1,3-dimethylpyrazol-5-yl)methylsulfanyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 79553961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).