C14H17F2N — CID 79554182
N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-difluoroaniline (PubChem CID 79554182) has the molecular formula C14H17F2N and a molecular weight of 237.29 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-difluoroaniline.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 79554182 |
| Molecular Formula | C14H17F2N |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-2,4-difluoroaniline |
| SMILES | Fc1ccc(NCC2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C14H17F2N/c15-12-3-4-14(13(16)7-12)17-8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11,17H,1-2,5-6,8H2 |
| InChIKey | NMFFYLQIVOOSHN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |