C15H18ClNO4 — CID 79555522
1-[(5-chloro-2-nitrophenyl)methyl]cycloheptane-1-carboxylic acid (PubChem CID 79555522) has the molecular formula C15H18ClNO4 and a molecular weight of 311.76 g/mol. Its IUPAC name is 1-[(5-chloro-2-nitrophenyl)methyl]cycloheptane-1-carboxylic acid.
| Compound Name | 1-[(5-chloro-2-nitrophenyl)methyl]cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 79555522 |
| Molecular Formula | C15H18ClNO4 |
| Molecular Weight | 311.76 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 1-[(5-chloro-2-nitrophenyl)methyl]cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2cc(Cl)ccc2[N+](=O)[O-])CCCCCC1 |
| InChI | InChI=1S/C15H18ClNO4/c16-12-5-6-13(17(20)21)11(9-12)10-15(14(18)19)7-3-1-2-4-8-15/h5-6,9H,1-4,7-8,10H2,(H,18,19) |
| InChIKey | GUUIVLVKRFTTTK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.76 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|