C12H13IN2O — CID 79556137
4-iodo-5-(2,4,6-trimethylphenyl)-1,2-oxazol-3-amine (PubChem CID 79556137) has the molecular formula C12H13IN2O and a molecular weight of 328.15 g/mol. Its IUPAC name is 4-iodo-5-(2,4,6-trimethylphenyl)-1,2-oxazol-3-amine.
| Compound Name | 4-iodo-5-(2,4,6-trimethylphenyl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 79556137 |
| Molecular Formula | C12H13IN2O |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 4-iodo-5-(2,4,6-trimethylphenyl)-1,2-oxazol-3-amine |
| SMILES | Cc1cc(C)c(-c2onc(N)c2I)c(C)c1 |
| InChI | InChI=1S/C12H13IN2O/c1-6-4-7(2)9(8(3)5-6)11-10(13)12(14)15-16-11/h4-5H,1-3H3,(H2,14,15) |
| InChIKey | CTQPZYQIJINFNV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|