About 4-chloro-5-ethyl-1,2-oxazol-3-amine
4-chloro-5-ethyl-1,2-oxazol-3-amine (PubChem CID 79556601) has the molecular formula C5H7ClN2O
and a molecular weight of 146.58 g/mol. Its IUPAC name is 4-chloro-5-ethyl-1,2-oxazol-3-amine.
Molecular Properties
| Compound Name | 4-chloro-5-ethyl-1,2-oxazol-3-amine |
| PubChem CID | 79556601 |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.58 g/mol |
| Exact Mass | 146.02 |
| IUPAC Name | 4-chloro-5-ethyl-1,2-oxazol-3-amine |
| SMILES | CCc1onc(N)c1Cl |
| InChI | InChI=1S/C5H7ClN2O/c1-2-3-4(6)5(7)8-9-3/h2H2,1H3,(H2,7,8) |
| InChIKey | RORYIXUJLCUDMX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-chloro-5-ethyl-1,2-oxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-5-ethyl-1,2-oxazol-3-amine?
The IUPAC name of 4-chloro-5-ethyl-1,2-oxazol-3-amine (CID 79556601) is 4-chloro-5-ethyl-1,2-oxazol-3-amine.
What is the SMILES notation for 4-chloro-5-ethyl-1,2-oxazol-3-amine?
The canonical SMILES for 4-chloro-5-ethyl-1,2-oxazol-3-amine is CCc1onc(N)c1Cl.
What is the InChIKey of 4-chloro-5-ethyl-1,2-oxazol-3-amine?
The InChIKey is RORYIXUJLCUDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O/c1-2-3-4(6)5(7)8-9-3/h2H2,1H3,(H2,7,8).
What are the key properties of 4-chloro-5-ethyl-1,2-oxazol-3-amine?
4-chloro-5-ethyl-1,2-oxazol-3-amine has a molecular weight of 146.58 g/mol, XLogP of 1.47, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-5-ethyl-1,2-oxazol-3-amine is sourced from PubChem (CID 79556601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).