C12H15ClN4O2S2 — CID 79557372
3-chloro-2-methyl-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propane-1-sulfonamide (PubChem CID 79557372) has the molecular formula C12H15ClN4O2S2 and a molecular weight of 346.87 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propane-1-sulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79557372 |
| Molecular Formula | C12H15ClN4O2S2 |
| Molecular Weight | 346.87 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 3-chloro-2-methyl-N-[4-(1H-1,2,4-triazol-5-ylsulfanyl)phenyl]propane-1-sulfonamide |
| SMILES | CC(CCl)CS(=O)(=O)Nc1ccc(Sc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C12H15ClN4O2S2/c1-9(6-13)7-21(18,19)17-10-2-4-11(5-3-10)20-12-14-8-15-16-12/h2-5,8-9,17H,6-7H2,1H3,(H,14,15,16) |
| InChIKey | IGZXUZWHWBYDGI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.87 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|