About 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine
5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine (PubChem CID 79557408) has the molecular formula C10H16ClN3
and a molecular weight of 213.71 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine |
| PubChem CID | 79557408 |
| Molecular Formula | C10H16ClN3 |
| Molecular Weight | 213.71 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine |
| SMILES | CC(C)C(C)CNc1ncc(Cl)cn1 |
| InChI | InChI=1S/C10H16ClN3/c1-7(2)8(3)4-12-10-13-5-9(11)6-14-10/h5-8H,4H2,1-3H3,(H,12,13,14) |
| InChIKey | GMXWJUVWGYBRNZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.71 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine?
The IUPAC name of 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine (CID 79557408) is 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine.
What is the SMILES notation for 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine?
The canonical SMILES for 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine is CC(C)C(C)CNc1ncc(Cl)cn1.
What is the InChIKey of 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine?
The InChIKey is GMXWJUVWGYBRNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3/c1-7(2)8(3)4-12-10-13-5-9(11)6-14-10/h5-8H,4H2,1-3H3,(H,12,13,14).
What are the key properties of 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine?
5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine has a molecular weight of 213.71 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(2,3-dimethylbutyl)pyrimidin-2-amine is sourced from PubChem (CID 79557408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).