C15H19NO4S — CID 79557559
3-[3-[1-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]phenyl]prop-2-enoic acid (PubChem CID 79557559) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is 3-[3-[1-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-[1-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79557559 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 3-[3-[1-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]phenyl]prop-2-enoic acid |
| SMILES | CC1CN(C(C)c2cccc(C=CC(=O)O)c2)S(=O)(=O)C1 |
| InChI | InChI=1S/C15H19NO4S/c1-11-9-16(21(19,20)10-11)12(2)14-5-3-4-13(8-14)6-7-15(17)18/h3-8,11-12H,9-10H2,1-2H3,(H,17,18) |
| InChIKey | QHYXPDVPEDAZRL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|