C10H18N2O5S — CID 79557763
1-[(2-methyl-2-methylsulfonylpropyl)carbamoyl]azetidine-3-carboxylic acid (PubChem CID 79557763) has the molecular formula C10H18N2O5S and a molecular weight of 278.33 g/mol. Its IUPAC name is 1-[(2-methyl-2-methylsulfonylpropyl)carbamoyl]azetidine-3-carboxylic acid.
| Compound Name | 1-[(2-methyl-2-methylsulfonylpropyl)carbamoyl]azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 79557763 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-[(2-methyl-2-methylsulfonylpropyl)carbamoyl]azetidine-3-carboxylic acid |
| SMILES | CC(C)(CNC(=O)N1CC(C(=O)O)C1)S(C)(=O)=O |
| InChI | InChI=1S/C10H18N2O5S/c1-10(2,18(3,16)17)6-11-9(15)12-4-7(5-12)8(13)14/h7H,4-6H2,1-3H3,(H,11,15)(H,13,14) |
| InChIKey | CHZFAGGBPDPMDO-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |