C19H29N4O2S+ — CID 7956141
diethyl-[2-[4-oxo-2-[2-oxo-2-(propylamino)ethyl]sulfanylquinazolin-3-yl]ethyl]azanium (PubChem CID 7956141) has the molecular formula C19H29N4O2S+ and a molecular weight of 377.53 g/mol. Its IUPAC name is diethyl-[2-[4-oxo-2-[2-oxo-2-(propylamino)ethyl]sulfanylquinazolin-3-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[4-oxo-2-[2-oxo-2-(propylamino)ethyl]sulfanylquinazolin-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 7956141 |
| Molecular Formula | C19H29N4O2S+ |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | diethyl-[2-[4-oxo-2-[2-oxo-2-(propylamino)ethyl]sulfanylquinazolin-3-yl]ethyl]azanium |
| SMILES | CCCNC(=O)CSc1nc2ccccc2c(=O)n1CC[NH+](CC)CC |
| InChI | InChI=1S/C19H28N4O2S/c1-4-11-20-17(24)14-26-19-21-16-10-8-7-9-15(16)18(25)23(19)13-12-22(5-2)6-3/h7-10H,4-6,11-14H2,1-3H3,(H,20,24)/p+1 |
| InChIKey | LRYTZAIGJLWXTI-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |