C18H26BrN — CID 79561700
2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-bromophenyl)-N-methylpropan-1-amine (PubChem CID 79561700) has the molecular formula C18H26BrN and a molecular weight of 336.32 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-bromophenyl)-N-methylpropan-1-amine.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-bromophenyl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 79561700 |
| Molecular Formula | C18H26BrN |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanylmethyl)-3-(4-bromophenyl)-N-methylpropan-1-amine |
| SMILES | CNCC(Cc1ccc(Br)cc1)CC1CC2CCC1C2 |
| InChI | InChI=1S/C18H26BrN/c1-20-12-15(8-13-3-6-18(19)7-4-13)11-17-10-14-2-5-16(17)9-14/h3-4,6-7,14-17,20H,2,5,8-12H2,1H3 |
| InChIKey | SLEDYDYPZIUUIX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |