About 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide
3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide (PubChem CID 79563054) has the molecular formula C10H22N2O3S
and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide.
Molecular Properties
| Compound Name | 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide |
| PubChem CID | 79563054 |
| Molecular Formula | C10H22N2O3S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide |
| SMILES | CC(C)(CN)C(=O)NCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C10H22N2O3S/c1-9(2,6-11)8(13)12-7-10(3,4)16(5,14)15/h6-7,11H2,1-5H3,(H,12,13) |
| InChIKey | BYPMPMAOGGHLME-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide?
The IUPAC name of 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide (CID 79563054) is 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide.
What is the SMILES notation for 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide?
The canonical SMILES for 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide is CC(C)(CN)C(=O)NCC(C)(C)S(C)(=O)=O.
What is the InChIKey of 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide?
The InChIKey is BYPMPMAOGGHLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O3S/c1-9(2,6-11)8(13)12-7-10(3,4)16(5,14)15/h6-7,11H2,1-5H3,(H,12,13).
What are the key properties of 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide?
3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide has a molecular weight of 250.36 g/mol, XLogP of -0.09, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,2-dimethyl-N-(2-methyl-2-methylsulfonylpropyl)propanamide is sourced from PubChem (CID 79563054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).