C15H30N2O2 — CID 79563584
methyl 1-(methylamino)-2-[2-[methyl(2-methylpropyl)amino]ethyl]cyclopentane-1-carboxylate (PubChem CID 79563584) has the molecular formula C15H30N2O2 and a molecular weight of 270.42 g/mol. Its IUPAC name is methyl 1-(methylamino)-2-[2-[methyl(2-methylpropyl)amino]ethyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-(methylamino)-2-[2-[methyl(2-methylpropyl)amino]ethyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 79563584 |
| Molecular Formula | C15H30N2O2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | methyl 1-(methylamino)-2-[2-[methyl(2-methylpropyl)amino]ethyl]cyclopentane-1-carboxylate |
| SMILES | CNC1(C(=O)OC)CCCC1CCN(C)CC(C)C |
| InChI | InChI=1S/C15H30N2O2/c1-12(2)11-17(4)10-8-13-7-6-9-15(13,16-3)14(18)19-5/h12-13,16H,6-11H2,1-5H3 |
| InChIKey | OOSGVEOUZOSNGK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |