About 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid
1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid (PubChem CID 79564083) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid |
| PubChem CID | 79564083 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1ccccc1N(C)CCC1CCCC1(N)C(=O)O |
| InChI | InChI=1S/C16H24N2O2/c1-12-6-3-4-8-14(12)18(2)11-9-13-7-5-10-16(13,17)15(19)20/h3-4,6,8,13H,5,7,9-11,17H2,1-2H3,(H,19,20) |
| InChIKey | GKMQQGPJWAULOB-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid?
The IUPAC name of 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid (CID 79564083) is 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid.
What is the SMILES notation for 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid?
The canonical SMILES for 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid is Cc1ccccc1N(C)CCC1CCCC1(N)C(=O)O.
What is the InChIKey of 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid?
The InChIKey is GKMQQGPJWAULOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-12-6-3-4-8-14(12)18(2)11-9-13-7-5-10-16(13,17)15(19)20/h3-4,6,8,13H,5,7,9-11,17H2,1-2H3,(H,19,20).
What are the key properties of 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid?
1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid has a molecular weight of 276.38 g/mol, XLogP of 2.40, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-[2-(N,2-dimethylanilino)ethyl]cyclopentane-1-carboxylic acid is sourced from PubChem (CID 79564083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).