About 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide
2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide (PubChem CID 79564242) has the molecular formula C16H31N3O
and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide |
| PubChem CID | 79564242 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide |
| SMILES | CNC1(C(N)=O)CCCC1CCN1CCCC(C)(C)C1 |
| InChI | InChI=1S/C16H31N3O/c1-15(2)8-5-10-19(12-15)11-7-13-6-4-9-16(13,18-3)14(17)20/h13,18H,4-12H2,1-3H3,(H2,17,20) |
| InChIKey | FKLXCMLRIYECAU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide?
The IUPAC name of 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide (CID 79564242) is 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide.
What is the SMILES notation for 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide?
The canonical SMILES for 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide is CNC1(C(N)=O)CCCC1CCN1CCCC(C)(C)C1.
What is the InChIKey of 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide?
The InChIKey is FKLXCMLRIYECAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H31N3O/c1-15(2)8-5-10-19(12-15)11-7-13-6-4-9-16(13,18-3)14(17)20/h13,18H,4-12H2,1-3H3,(H2,17,20).
What are the key properties of 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide?
2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide has a molecular weight of 281.44 g/mol, XLogP of 1.74, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,3-dimethylpiperidin-1-yl)ethyl]-1-(methylamino)cyclopentane-1-carboxamide is sourced from PubChem (CID 79564242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).