C16H29N3O — CID 79564461
2-[2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)ethyl]-1-aminocyclopentane-1-carboxamide (PubChem CID 79564461) has the molecular formula C16H29N3O and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-[2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)ethyl]-1-aminocyclopentane-1-carboxamide.
| Compound Name | 2-[2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)ethyl]-1-aminocyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 79564461 |
| Molecular Formula | C16H29N3O |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.23 |
| IUPAC Name | 2-[2-(2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridin-1-yl)ethyl]-1-aminocyclopentane-1-carboxamide |
| SMILES | NC(=O)C1(N)CCCC1CCN1CCCC2CCCC21 |
| InChI | InChI=1S/C16H29N3O/c17-15(20)16(18)9-2-6-13(16)8-11-19-10-3-5-12-4-1-7-14(12)19/h12-14H,1-11,18H2,(H2,17,20) |
| InChIKey | GZIWRTYZNJNLTI-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |