About N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline
N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline (PubChem CID 79565816) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline.
Molecular Properties
| Compound Name | N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline |
| PubChem CID | 79565816 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline |
| SMILES | Cc1cc(C)cc(N(C)CCC2CCCC2N)c1 |
| InChI | InChI=1S/C16H26N2/c1-12-9-13(2)11-15(10-12)18(3)8-7-14-5-4-6-16(14)17/h9-11,14,16H,4-8,17H2,1-3H3 |
| InChIKey | KBLFEHYTTTVMAQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline?
The IUPAC name of N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline (CID 79565816) is N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline.
What is the SMILES notation for N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline?
The canonical SMILES for N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline is Cc1cc(C)cc(N(C)CCC2CCCC2N)c1.
What is the InChIKey of N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline?
The InChIKey is KBLFEHYTTTVMAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2/c1-12-9-13(2)11-15(10-12)18(3)8-7-14-5-4-6-16(14)17/h9-11,14,16H,4-8,17H2,1-3H3.
What are the key properties of N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline?
N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline has a molecular weight of 246.40 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-aminocyclopentyl)ethyl]-N,3,5-trimethylaniline is sourced from PubChem (CID 79565816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).