C17H34N2O2 — CID 79566945
[1-(ethylamino)-2-[2-[methyl(oxan-2-ylmethyl)amino]ethyl]cyclopentyl]methanol (PubChem CID 79566945) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is [1-(ethylamino)-2-[2-[methyl(oxan-2-ylmethyl)amino]ethyl]cyclopentyl]methanol.
| Compound Name | [1-(ethylamino)-2-[2-[methyl(oxan-2-ylmethyl)amino]ethyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 79566945 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | [1-(ethylamino)-2-[2-[methyl(oxan-2-ylmethyl)amino]ethyl]cyclopentyl]methanol |
| SMILES | CCNC1(CO)CCCC1CCN(C)CC1CCCCO1 |
| InChI | InChI=1S/C17H34N2O2/c1-3-18-17(14-20)10-6-7-15(17)9-11-19(2)13-16-8-4-5-12-21-16/h15-16,18,20H,3-14H2,1-2H3 |
| InChIKey | XAIFTNRTHWFBSW-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |