About [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol
[1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol (PubChem CID 79567772) has the molecular formula C15H28N2O3S
and a molecular weight of 316.47 g/mol. Its IUPAC name is [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol |
| PubChem CID | 79567772 |
| Molecular Formula | C15H28N2O3S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol |
| SMILES | O=S1(=O)CCN(CCC2CCCC2(CO)NC2CC2)CC1 |
| InChI | InChI=1S/C15H28N2O3S/c18-12-15(16-14-3-4-14)6-1-2-13(15)5-7-17-8-10-21(19,20)11-9-17/h13-14,16,18H,1-12H2 |
| InChIKey | ATPGYLSOOYRPSU-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol?
The IUPAC name of [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol (CID 79567772) is [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol.
What is the SMILES notation for [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol?
The canonical SMILES for [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol is O=S1(=O)CCN(CCC2CCCC2(CO)NC2CC2)CC1.
What is the InChIKey of [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol?
The InChIKey is ATPGYLSOOYRPSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2O3S/c18-12-15(16-14-3-4-14)6-1-2-13(15)5-7-17-8-10-21(19,20)11-9-17/h13-14,16,18H,1-12H2.
What are the key properties of [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol?
[1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol has a molecular weight of 316.47 g/mol, XLogP of 0.39, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(cyclopropylamino)-2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]cyclopentyl]methanol is sourced from PubChem (CID 79567772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).