C13H19F3N2O2S — CID 79569032
4-amino-2,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 79569032) has the molecular formula C13H19F3N2O2S and a molecular weight of 324.37 g/mol. Its IUPAC name is 4-amino-2,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 79569032 |
| Molecular Formula | C13H19F3N2O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-amino-2,6-dimethyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H19F3N2O2S/c1-8(2)18(7-13(14,15)16)21(19,20)12-9(3)5-11(17)6-10(12)4/h5-6,8H,7,17H2,1-4H3 |
| InChIKey | GXTIRTODPYJPKR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|