C13H17N3O4S — CID 79570373
4-amino-2,6-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 79570373) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-amino-2,6-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 4-amino-2,6-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 79570373 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-amino-2,6-dimethyl-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | Cc1cc(N)cc(C)c1S(=O)(=O)NC1CC(=O)N(C)C1=O |
| InChI | InChI=1S/C13H17N3O4S/c1-7-4-9(14)5-8(2)12(7)21(19,20)15-10-6-11(17)16(3)13(10)18/h4-5,10,15H,6,14H2,1-3H3 |
| InChIKey | WGNZVOPAGCIGIS-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|