About 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one
2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one (PubChem CID 79570867) has the molecular formula C15H14N4O2
and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one |
| PubChem CID | 79570867 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(-c2nc(O)c(-c3ccccc3)c(=O)[nH]2)cnn1C |
| InChI | InChI=1S/C15H14N4O2/c1-9-11(8-16-19(9)2)13-17-14(20)12(15(21)18-13)10-6-4-3-5-7-10/h3-8H,1-2H3,(H2,17,18,20,21) |
| InChIKey | YCJVYDOPBMGERI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one?
The IUPAC name of 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one (CID 79570867) is 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one.
What is the SMILES notation for 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one?
The canonical SMILES for 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one is Cc1c(-c2nc(O)c(-c3ccccc3)c(=O)[nH]2)cnn1C.
What is the InChIKey of 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one?
The InChIKey is YCJVYDOPBMGERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2/c1-9-11(8-16-19(9)2)13-17-14(20)12(15(21)18-13)10-6-4-3-5-7-10/h3-8H,1-2H3,(H2,17,18,20,21).
What are the key properties of 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one?
2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one has a molecular weight of 282.30 g/mol, XLogP of 1.85, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5-dimethylpyrazol-4-yl)-4-hydroxy-5-phenyl-1H-pyrimidin-6-one is sourced from PubChem (CID 79570867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).