About [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol
[2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol (PubChem CID 79570893) has the molecular formula C14H28N2O3S
and a molecular weight of 304.46 g/mol. Its IUPAC name is [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol.
Molecular Properties
| Compound Name | [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol |
| PubChem CID | 79570893 |
| Molecular Formula | C14H28N2O3S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol |
| SMILES | CCNC1(CO)CCCC1CCN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H28N2O3S/c1-2-15-14(12-17)6-3-4-13(14)5-7-16-8-10-20(18,19)11-9-16/h13,15,17H,2-12H2,1H3 |
| InChIKey | JCPITBUMOSVWFV-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol?
The IUPAC name of [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol (CID 79570893) is [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol.
What is the SMILES notation for [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol?
The canonical SMILES for [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol is CCNC1(CO)CCCC1CCN1CCS(=O)(=O)CC1.
What is the InChIKey of [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol?
The InChIKey is JCPITBUMOSVWFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O3S/c1-2-15-14(12-17)6-3-4-13(14)5-7-16-8-10-20(18,19)11-9-16/h13,15,17H,2-12H2,1H3.
What are the key properties of [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol?
[2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol has a molecular weight of 304.46 g/mol, XLogP of 0.25, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-(ethylamino)cyclopentyl]methanol is sourced from PubChem (CID 79570893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).