About [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol
[1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol (PubChem CID 79571309) has the molecular formula C13H26N2O3S
and a molecular weight of 290.43 g/mol. Its IUPAC name is [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol.
Molecular Properties
| Compound Name | [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol |
| PubChem CID | 79571309 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol |
| SMILES | CN(CCC1CCCC1(N)CO)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H26N2O3S/c1-15(12-5-8-19(17,18)9-12)7-4-11-3-2-6-13(11,14)10-16/h11-12,16H,2-10,14H2,1H3 |
| InChIKey | UNCOWFMCMUBZBJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol?
The IUPAC name of [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol (CID 79571309) is [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol.
What is the SMILES notation for [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol?
The canonical SMILES for [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol is CN(CCC1CCCC1(N)CO)C1CCS(=O)(=O)C1.
What is the InChIKey of [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol?
The InChIKey is UNCOWFMCMUBZBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3S/c1-15(12-5-8-19(17,18)9-12)7-4-11-3-2-6-13(11,14)10-16/h11-12,16H,2-10,14H2,1H3.
What are the key properties of [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol?
[1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol has a molecular weight of 290.43 g/mol, XLogP of -0.01, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-amino-2-[2-[(1,1-dioxothiolan-3-yl)-methylamino]ethyl]cyclopentyl]methanol is sourced from PubChem (CID 79571309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).