C17H24N2O — CID 79573048
2-[2-(3-ethylphenoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile (PubChem CID 79573048) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[2-(3-ethylphenoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile.
| Compound Name | 2-[2-(3-ethylphenoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 79573048 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-[2-(3-ethylphenoxy)ethyl]-1-(methylamino)cyclopentane-1-carbonitrile |
| SMILES | CCc1cccc(OCCC2CCCC2(C#N)NC)c1 |
| InChI | InChI=1S/C17H24N2O/c1-3-14-6-4-8-16(12-14)20-11-9-15-7-5-10-17(15,13-18)19-2/h4,6,8,12,15,19H,3,5,7,9-11H2,1-2H3 |
| InChIKey | YXCBYLPUABOGKE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |