About methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate
methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate (PubChem CID 79573077) has the molecular formula C16H27N3O2
and a molecular weight of 293.41 g/mol. Its IUPAC name is methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate |
| PubChem CID | 79573077 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate |
| SMILES | CCc1c(C)nn(CCC2CCCC2(N)C(=O)OC)c1C |
| InChI | InChI=1S/C16H27N3O2/c1-5-14-11(2)18-19(12(14)3)10-8-13-7-6-9-16(13,17)15(20)21-4/h13H,5-10,17H2,1-4H3 |
| InChIKey | IVARZPGMTLKFDS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate?
The IUPAC name of methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate (CID 79573077) is methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate?
The canonical SMILES for methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate is CCc1c(C)nn(CCC2CCCC2(N)C(=O)OC)c1C.
What is the InChIKey of methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate?
The InChIKey is IVARZPGMTLKFDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27N3O2/c1-5-14-11(2)18-19(12(14)3)10-8-13-7-6-9-16(13,17)15(20)21-4/h13H,5-10,17H2,1-4H3.
What are the key properties of methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate?
methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate has a molecular weight of 293.41 g/mol, XLogP of 2.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-amino-2-[2-(4-ethyl-3,5-dimethylpyrazol-1-yl)ethyl]cyclopentane-1-carboxylate is sourced from PubChem (CID 79573077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).