About 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile
1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile (PubChem CID 79573611) has the molecular formula C12H20F3N3
and a molecular weight of 263.31 g/mol. Its IUPAC name is 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile.
Molecular Properties
| Compound Name | 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile |
| PubChem CID | 79573611 |
| Molecular Formula | C12H20F3N3 |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile |
| SMILES | CN(CCC1CCCC1(N)C#N)CCC(F)(F)F |
| InChI | InChI=1S/C12H20F3N3/c1-18(8-6-12(13,14)15)7-4-10-3-2-5-11(10,17)9-16/h10H,2-8,17H2,1H3 |
| InChIKey | TYCJMUXUWYKVFF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile?
The IUPAC name of 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile (CID 79573611) is 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile.
What is the SMILES notation for 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile?
The canonical SMILES for 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile is CN(CCC1CCCC1(N)C#N)CCC(F)(F)F.
What is the InChIKey of 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile?
The InChIKey is TYCJMUXUWYKVFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20F3N3/c1-18(8-6-12(13,14)15)7-4-10-3-2-5-11(10,17)9-16/h10H,2-8,17H2,1H3.
What are the key properties of 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile?
1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile has a molecular weight of 263.31 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2-[2-[methyl(3,3,3-trifluoropropyl)amino]ethyl]cyclopentane-1-carbonitrile is sourced from PubChem (CID 79573611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).