C19H30N2O — CID 795749
N,N-diethyl-1-(3-phenylpropyl)piperidine-4-carboxamide (PubChem CID 795749) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is N,N-diethyl-1-(3-phenylpropyl)piperidine-4-carboxamide.
| Compound Name | N,N-diethyl-1-(3-phenylpropyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 795749 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | N,N-diethyl-1-(3-phenylpropyl)piperidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCN(CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C19H30N2O/c1-3-21(4-2)19(22)18-12-15-20(16-13-18)14-8-11-17-9-6-5-7-10-17/h5-7,9-10,18H,3-4,8,11-16H2,1-2H3 |
| InChIKey | NXGAAMVGCAETFE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |