C13H19F2NO — CID 79575096
1-(2,5-difluorophenyl)-N-ethyl-2-propan-2-yloxyethanamine (PubChem CID 79575096) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-N-ethyl-2-propan-2-yloxyethanamine.
| Compound Name | 1-(2,5-difluorophenyl)-N-ethyl-2-propan-2-yloxyethanamine |
|---|---|
| PubChem CID | 79575096 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)-N-ethyl-2-propan-2-yloxyethanamine |
| SMILES | CCNC(COC(C)C)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H19F2NO/c1-4-16-13(8-17-9(2)3)11-7-10(14)5-6-12(11)15/h5-7,9,13,16H,4,8H2,1-3H3 |
| InChIKey | UNPYCBJTCSVVML-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |