C12H17ClFNO — CID 79575550
1-(3-chloro-4-fluorophenyl)-2-ethoxy-N-ethylethanamine (PubChem CID 79575550) has the molecular formula C12H17ClFNO and a molecular weight of 245.72 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-2-ethoxy-N-ethylethanamine.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-2-ethoxy-N-ethylethanamine |
|---|---|
| PubChem CID | 79575550 |
| Molecular Formula | C12H17ClFNO |
| Molecular Weight | 245.72 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-2-ethoxy-N-ethylethanamine |
| SMILES | CCNC(COCC)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClFNO/c1-3-15-12(8-16-4-2)9-5-6-11(14)10(13)7-9/h5-7,12,15H,3-4,8H2,1-2H3 |
| InChIKey | VLLAHALXRYUQQC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.72 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |