C15H15FN4O3S — CID 7957670
N-(2-cyanoethyl)-2-[[5-[(1S)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7957670) has the molecular formula C15H15FN4O3S and a molecular weight of 350.38 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-[[5-[(1S)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-(2-cyanoethyl)-2-[[5-[(1S)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7957670 |
| Molecular Formula | C15H15FN4O3S |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | N-(2-cyanoethyl)-2-[[5-[(1S)-1-(4-fluorophenoxy)ethyl]-1,3,4-oxadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C[C@H](Oc1ccc(F)cc1)c1nnc(SCC(=O)NCCC#N)o1 |
| InChI | InChI=1S/C15H15FN4O3S/c1-10(22-12-5-3-11(16)4-6-12)14-19-20-15(23-14)24-9-13(21)18-8-2-7-17/h3-6,10H,2,8-9H2,1H3,(H,18,21)/t10-/m0/s1 |
| InChIKey | PQZYKRAWMZFXTL-JTQLQIEISA-N |
| XLogP | 2.47 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|