About 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one
2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one (PubChem CID 79577643) has the molecular formula C17H19NO2S
and a molecular weight of 301.41 g/mol. Its IUPAC name is 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one.
Molecular Properties
| Compound Name | 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one |
| PubChem CID | 79577643 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one |
| SMILES | Cc1csc(-c2ccc(OCCC3CCCC3=O)cc2)n1 |
| InChI | InChI=1S/C17H19NO2S/c1-12-11-21-17(18-12)14-5-7-15(8-6-14)20-10-9-13-3-2-4-16(13)19/h5-8,11,13H,2-4,9-10H2,1H3 |
| InChIKey | XZLYOALFFVFMOH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one?
The IUPAC name of 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one (CID 79577643) is 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one.
What is the SMILES notation for 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one?
The canonical SMILES for 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one is Cc1csc(-c2ccc(OCCC3CCCC3=O)cc2)n1.
What is the InChIKey of 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one?
The InChIKey is XZLYOALFFVFMOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO2S/c1-12-11-21-17(18-12)14-5-7-15(8-6-14)20-10-9-13-3-2-4-16(13)19/h5-8,11,13H,2-4,9-10H2,1H3.
What are the key properties of 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one?
2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one has a molecular weight of 301.41 g/mol, XLogP of 4.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(4-methyl-1,3-thiazol-2-yl)phenoxy]ethyl]cyclopentan-1-one is sourced from PubChem (CID 79577643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).