C12H20N4O — CID 79578454
3-[(1,5-dimethylpyrazol-4-yl)methylamino]azepan-2-one (PubChem CID 79578454) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-[(1,5-dimethylpyrazol-4-yl)methylamino]azepan-2-one.
| Compound Name | 3-[(1,5-dimethylpyrazol-4-yl)methylamino]azepan-2-one |
|---|---|
| PubChem CID | 79578454 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 3-[(1,5-dimethylpyrazol-4-yl)methylamino]azepan-2-one |
| SMILES | Cc1c(CNC2CCCCNC2=O)cnn1C |
| InChI | InChI=1S/C12H20N4O/c1-9-10(8-15-16(9)2)7-14-11-5-3-4-6-13-12(11)17/h8,11,14H,3-7H2,1-2H3,(H,13,17) |
| InChIKey | JMAKMAOCGJPLET-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |