About 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide
2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide (PubChem CID 79579380) has the molecular formula C7H12N2O5S
and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide |
| PubChem CID | 79579380 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide |
| SMILES | CN1C(=O)CC(NS(=O)(=O)CCO)C1=O |
| InChI | InChI=1S/C7H12N2O5S/c1-9-6(11)4-5(7(9)12)8-15(13,14)3-2-10/h5,8,10H,2-4H2,1H3 |
| InChIKey | BZJVZWLDULYOOB-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide?
The IUPAC name of 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide (CID 79579380) is 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide.
What is the SMILES notation for 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide?
The canonical SMILES for 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide is CN1C(=O)CC(NS(=O)(=O)CCO)C1=O.
What is the InChIKey of 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide?
The InChIKey is BZJVZWLDULYOOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O5S/c1-9-6(11)4-5(7(9)12)8-15(13,14)3-2-10/h5,8,10H,2-4H2,1H3.
What are the key properties of 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide?
2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide has a molecular weight of 236.25 g/mol, XLogP of -2.34, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(1-methyl-2,5-dioxopyrrolidin-3-yl)ethanesulfonamide is sourced from PubChem (CID 79579380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).