About [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine
[4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine (PubChem CID 79579759) has the molecular formula C12H15F3N2O2S
and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 79579759 |
| Molecular Formula | C12H15F3N2O2S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine |
| SMILES | CC1CN(c2ccc(CN)c(C(F)(F)F)c2)S(=O)(=O)C1 |
| InChI | InChI=1S/C12H15F3N2O2S/c1-8-6-17(20(18,19)7-8)10-3-2-9(5-16)11(4-10)12(13,14)15/h2-4,8H,5-7,16H2,1H3 |
| InChIKey | JGKJWUBKTNKFJV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine?
The IUPAC name of [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine (CID 79579759) is [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine is CC1CN(c2ccc(CN)c(C(F)(F)F)c2)S(=O)(=O)C1.
What is the InChIKey of [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine?
The InChIKey is JGKJWUBKTNKFJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N2O2S/c1-8-6-17(20(18,19)7-8)10-3-2-9(5-16)11(4-10)12(13,14)15/h2-4,8H,5-7,16H2,1H3.
What are the key properties of [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine?
[4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine has a molecular weight of 308.33 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-2-(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 79579759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).