About 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide
2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide (PubChem CID 79579773) has the molecular formula C10H20N2O2S2
and a molecular weight of 264.42 g/mol. Its IUPAC name is 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide.
Molecular Properties
| Compound Name | 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide |
| PubChem CID | 79579773 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide |
| SMILES | CCC(CC)(C(N)=S)N1CC(C)CS1(=O)=O |
| InChI | InChI=1S/C10H20N2O2S2/c1-4-10(5-2,9(11)15)12-6-8(3)7-16(12,13)14/h8H,4-7H2,1-3H3,(H2,11,15) |
| InChIKey | MYHMYUIVKNXISP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide?
The IUPAC name of 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide (CID 79579773) is 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide.
What is the SMILES notation for 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide?
The canonical SMILES for 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide is CCC(CC)(C(N)=S)N1CC(C)CS1(=O)=O.
What is the InChIKey of 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide?
The InChIKey is MYHMYUIVKNXISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2S2/c1-4-10(5-2,9(11)15)12-6-8(3)7-16(12,13)14/h8H,4-7H2,1-3H3,(H2,11,15).
What are the key properties of 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide?
2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide has a molecular weight of 264.42 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanethioamide is sourced from PubChem (CID 79579773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).