About 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile
2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile (PubChem CID 79580018) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile.
Molecular Properties
| Compound Name | 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile |
| PubChem CID | 79580018 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile |
| SMILES | CCC(C#N)N1CC(C)CS1(=O)=O |
| InChI | InChI=1S/C8H14N2O2S/c1-3-8(4-9)10-5-7(2)6-13(10,11)12/h7-8H,3,5-6H2,1-2H3 |
| InChIKey | NMINNYSCDYNGIJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile?
The IUPAC name of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile (CID 79580018) is 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile.
What is the SMILES notation for 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile?
The canonical SMILES for 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile is CCC(C#N)N1CC(C)CS1(=O)=O.
What is the InChIKey of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile?
The InChIKey is NMINNYSCDYNGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-3-8(4-9)10-5-7(2)6-13(10,11)12/h7-8H,3,5-6H2,1-2H3.
What are the key properties of 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile?
2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile has a molecular weight of 202.28 g/mol, XLogP of 0.57, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)butanenitrile is sourced from PubChem (CID 79580018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).