About 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine
4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine (PubChem CID 79580707) has the molecular formula C13H26N2O2S
and a molecular weight of 274.43 g/mol. Its IUPAC name is 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine |
| PubChem CID | 79580707 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCC(N2CC(C)CS2(=O)=O)CC1 |
| InChI | InChI=1S/C13H26N2O2S/c1-3-8-14-12-4-6-13(7-5-12)15-9-11(2)10-18(15,16)17/h11-14H,3-10H2,1-2H3 |
| InChIKey | ADWOPRTWXKYERQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine?
The IUPAC name of 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine (CID 79580707) is 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine.
What is the SMILES notation for 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine?
The canonical SMILES for 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine is CCCNC1CCC(N2CC(C)CS2(=O)=O)CC1.
What is the InChIKey of 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine?
The InChIKey is ADWOPRTWXKYERQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2S/c1-3-8-14-12-4-6-13(7-5-12)15-9-11(2)10-18(15,16)17/h11-14H,3-10H2,1-2H3.
What are the key properties of 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine?
4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine has a molecular weight of 274.43 g/mol, XLogP of 1.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methyl-1,1-dioxo-1,2-thiazolidin-2-yl)-N-propylcyclohexan-1-amine is sourced from PubChem (CID 79580707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).